C7H7IN4 — CID 134516677
6-iodo-3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 134516677) has the molecular formula C7H7IN4 and a molecular weight of 274.07 g/mol. Its IUPAC name is 6-iodo-3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-iodo-3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 134516677 |
| Molecular Formula | C7H7IN4 |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 6-iodo-3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cc1cc(I)nn2c(C)nnc12 |
| InChI | InChI=1S/C7H7IN4/c1-4-3-6(8)11-12-5(2)9-10-7(4)12/h3H,1-2H3 |
| InChIKey | MFUHQZJENBVOSB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|