C15H23F — CID 134517712
(4E,6Z,9E)-5-fluoro-2-methyl-9-propan-2-ylundeca-1,4,6,9-tetraene (PubChem CID 134517712) has the molecular formula C15H23F and a molecular weight of 222.35 g/mol. Its IUPAC name is (4E,6Z,9E)-5-fluoro-2-methyl-9-propan-2-ylundeca-1,4,6,9-tetraene.
| Compound Name | (4E,6Z,9E)-5-fluoro-2-methyl-9-propan-2-ylundeca-1,4,6,9-tetraene |
|---|---|
| PubChem CID | 134517712 |
| Molecular Formula | C15H23F |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (4E,6Z,9E)-5-fluoro-2-methyl-9-propan-2-ylundeca-1,4,6,9-tetraene |
| SMILES | C=C(C)C/C=C(F)\C=C/C/C(=C\C)C(C)C |
| InChI | InChI=1S/C15H23F/c1-6-14(13(4)5)8-7-9-15(16)11-10-12(2)3/h6-7,9,11,13H,2,8,10H2,1,3-5H3/b9-7-,14-6+,15-11+ |
| InChIKey | MPPBYOYMDWWGKE-ALNFHKIESA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|