C15H20O9 — CID 134517744
[(5R,6R,7R)-6,7-diacetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate (PubChem CID 134517744) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is [(5R,6R,7R)-6,7-diacetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate.
| Compound Name | [(5R,6R,7R)-6,7-diacetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate |
|---|---|
| PubChem CID | 134517744 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(5R,6R,7R)-6,7-diacetyloxy-3-methyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC2C(C)C(=O)OC2[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-6-11-13(24-15(6)19)14(22-9(4)18)12(21-8(3)17)10(23-11)5-20-7(2)16/h6,10-14H,5H2,1-4H3/t6?,10-,11?,12-,13?,14+/m1/s1 |
| InChIKey | ZVTBSDJAKOVKEZ-IDOMPOBOSA-N |
| XLogP | -0.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|