About 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine
5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine (PubChem CID 13451788) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine |
| PubChem CID | 13451788 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine |
| SMILES | CCCn1nc(N)nc1SC |
| InChI | InChI=1S/C6H12N4S/c1-3-4-10-6(11-2)8-5(7)9-10/h3-4H2,1-2H3,(H2,7,9) |
| InChIKey | UNIJABCNUIQDSC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine (CID 13451788) is 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine is CCCn1nc(N)nc1SC.
What is the InChIKey of 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine?
The InChIKey is UNIJABCNUIQDSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-3-4-10-6(11-2)8-5(7)9-10/h3-4H2,1-2H3,(H2,7,9).
What are the key properties of 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine?
5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine has a molecular weight of 172.26 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-1-propyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 13451788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).