C36H37F4N5O5 — CID 134519215
[(E)-5-(methylamino)-5-oxopent-3-enyl] N-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate (PubChem CID 134519215) has the molecular formula C36H37F4N5O5 and a molecular weight of 695.71 g/mol. Its IUPAC name is [(E)-5-(methylamino)-5-oxopent-3-enyl] N-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate.
| Compound Name | [(E)-5-(methylamino)-5-oxopent-3-enyl] N-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 134519215 |
| Molecular Formula | C36H37F4N5O5 |
| Molecular Weight | 695.71 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | [(E)-5-(methylamino)-5-oxopent-3-enyl] N-[2-[[5-[(Z)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate |
| SMILES | CNC(=O)/C=C/CCOC(=O)NCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C36H37F4N5O5/c1-41-30(46)11-5-7-19-50-35(47)42-17-20-48-31-16-14-26(23-43-31)33(28(22-36(38,39)40)24-9-3-2-4-10-24)25-13-15-29-27(21-25)34(37)44-45(29)32-12-6-8-18-49-32/h2-5,9-11,13-16,21,23,32H,6-8,12,17-20,22H2,1H3,(H,41,46)(H,42,47)/b11-5+,33-28- |
| InChIKey | GKVJHRSEYFCHGA-SXELREOFSA-N |
| XLogP | 6.98 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.71 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|