C32H33F4N5O2 — CID 134519223
1-pyrrolidin-1-yl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butan-1-one (PubChem CID 134519223) has the molecular formula C32H33F4N5O2 and a molecular weight of 595.64 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butan-1-one.
| Compound Name | 1-pyrrolidin-1-yl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butan-1-one |
|---|---|
| PubChem CID | 134519223 |
| Molecular Formula | C32H33F4N5O2 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 1-pyrrolidin-1-yl-4-[2-[[5-[4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butan-1-one |
| SMILES | O=C(CCCNCCOc1ccc(C(=C(CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1)N1CCCC1 |
| InChI | InChI=1S/C32H33F4N5O2/c33-31-25-19-23(10-12-27(25)39-40-31)30(26(20-32(34,35)36)22-7-2-1-3-8-22)24-11-13-28(38-21-24)43-18-15-37-14-6-9-29(42)41-16-4-5-17-41/h1-3,7-8,10-13,19,21,37H,4-6,9,14-18,20H2,(H,39,40) |
| InChIKey | QYYYJCGBSIXFJV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|