C32H31F4N5O3 — CID 134519229
(E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one (PubChem CID 134519229) has the molecular formula C32H31F4N5O3 and a molecular weight of 609.62 g/mol. Its IUPAC name is (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one.
| Compound Name | (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
|---|---|
| PubChem CID | 134519229 |
| Molecular Formula | C32H31F4N5O3 |
| Molecular Weight | 609.62 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
| SMILES | O=C(/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1)N1CCOCC1 |
| InChI | InChI=1S/C32H31F4N5O3/c33-31-25-19-23(8-10-27(25)39-40-31)30(26(20-32(34,35)36)22-5-2-1-3-6-22)24-9-11-28(38-21-24)44-16-13-37-12-4-7-29(42)41-14-17-43-18-15-41/h1-11,19,21,37H,12-18,20H2,(H,39,40)/b7-4+,30-26- |
| InChIKey | OJFPFLZMCBOQTK-ZWAWHEGESA-N |
| XLogP | 5.39 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|