C30H27F4N5O2 — CID 134519231
3-[2-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]ethylidene]pyrrolidin-2-one (PubChem CID 134519231) has the molecular formula C30H27F4N5O2 and a molecular weight of 565.57 g/mol. Its IUPAC name is 3-[2-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]ethylidene]pyrrolidin-2-one.
| Compound Name | 3-[2-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]ethylidene]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134519231 |
| Molecular Formula | C30H27F4N5O2 |
| Molecular Weight | 565.57 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 3-[2-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]ethylidene]pyrrolidin-2-one |
| SMILES | O=C1NCCC1=CCNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1 |
| InChI | InChI=1S/C30H27F4N5O2/c31-28-23-16-21(6-8-25(23)38-39-28)27(24(17-30(32,33)34)19-4-2-1-3-5-19)22-7-9-26(37-18-22)41-15-14-35-12-10-20-11-13-36-29(20)40/h1-10,16,18,35H,11-15,17H2,(H,36,40)(H,38,39)/b20-10?,27-24- |
| InChIKey | JUADRDQORAZAIT-AUXTXRAMSA-N |
| XLogP | 5.42 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|