C29H27F4N5O2 — CID 134519235
(E)-N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide (PubChem CID 134519235) has the molecular formula C29H27F4N5O2 and a molecular weight of 553.56 g/mol. Its IUPAC name is (E)-N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide.
| Compound Name | (E)-N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 134519235 |
| Molecular Formula | C29H27F4N5O2 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | (E)-N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
| SMILES | CNC(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1 |
| InChI | InChI=1S/C29H27F4N5O2/c1-34-25(39)8-5-13-35-14-15-40-26-12-10-21(18-36-26)27(20-9-11-24-22(16-20)28(30)38-37-24)23(17-29(31,32)33)19-6-3-2-4-7-19/h2-12,16,18,35H,13-15,17H2,1H3,(H,34,39)(H,37,38)/b8-5+,27-23- |
| InChIKey | OPZPCDDIWZRVIJ-SWPRNGIESA-N |
| XLogP | 5.28 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|