C32H34FN5O2 — CID 134519255
(E)-4-[2-[[5-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]-1-pyrrolidin-1-ylbut-2-en-1-one (PubChem CID 134519255) has the molecular formula C32H34FN5O2 and a molecular weight of 539.66 g/mol. Its IUPAC name is (E)-4-[2-[[5-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]-1-pyrrolidin-1-ylbut-2-en-1-one.
| Compound Name | (E)-4-[2-[[5-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]-1-pyrrolidin-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 134519255 |
| Molecular Formula | C32H34FN5O2 |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (E)-4-[2-[[5-[(Z)-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]-1-pyrrolidin-1-ylbut-2-en-1-one |
| SMILES | CC/C(=C(/c1ccc(OCCNC/C=C/C(=O)N2CCCC2)nc1)c1ccc2n[nH]c(F)c2c1)c1ccccc1 |
| InChI | InChI=1S/C32H34FN5O2/c1-2-26(23-9-4-3-5-10-23)31(24-12-14-28-27(21-24)32(33)37-36-28)25-13-15-29(35-22-25)40-20-17-34-16-8-11-30(39)38-18-6-7-19-38/h3-5,8-15,21-22,34H,2,6-7,16-20H2,1H3,(H,36,37)/b11-8+,31-26- |
| InChIKey | VXQKZHJODYEMPG-WLOFBZDBSA-N |
| XLogP | 5.61 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|