C32H33F4N5O3 — CID 134519266
(E)-N-(2-hydroxyethyl)-N-methyl-5-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]pent-2-enamide (PubChem CID 134519266) has the molecular formula C32H33F4N5O3 and a molecular weight of 611.64 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-N-methyl-5-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]pent-2-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-N-methyl-5-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]pent-2-enamide |
|---|---|
| PubChem CID | 134519266 |
| Molecular Formula | C32H33F4N5O3 |
| Molecular Weight | 611.64 g/mol |
| Exact Mass | 611.25 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-N-methyl-5-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]pent-2-enamide |
| SMILES | CN(CCO)C(=O)/C=C/CCNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1 |
| InChI | InChI=1S/C32H33F4N5O3/c1-41(16-17-42)29(43)9-5-6-14-37-15-18-44-28-13-11-24(21-38-28)30(23-10-12-27-25(19-23)31(33)40-39-27)26(20-32(34,35)36)22-7-3-2-4-8-22/h2-5,7-13,19,21,37,42H,6,14-18,20H2,1H3,(H,39,40)/b9-5+,30-26- |
| InChIKey | PNBBATFDZXMVHZ-WIYCTTRQSA-N |
| XLogP | 5.37 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|