C32H32F3N5O3 — CID 134519275
(E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one (PubChem CID 134519275) has the molecular formula C32H32F3N5O3 and a molecular weight of 591.63 g/mol. Its IUPAC name is (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one.
| Compound Name | (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
|---|---|
| PubChem CID | 134519275 |
| Molecular Formula | C32H32F3N5O3 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | (E)-1-morpholin-4-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
| SMILES | O=C(/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3[nH]ncc3c2)cn1)N1CCOCC1 |
| InChI | InChI=1S/C32H32F3N5O3/c33-32(34,35)20-27(23-5-2-1-3-6-23)31(24-8-10-28-26(19-24)22-38-39-28)25-9-11-29(37-21-25)43-16-13-36-12-4-7-30(41)40-14-17-42-18-15-40/h1-11,19,21-22,36H,12-18,20H2,(H,38,39)/b7-4+,31-27- |
| InChIKey | NIBFVNNPMOKALZ-ALTBYKGOSA-N |
| XLogP | 5.25 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|