C31H31F4N5O3 — CID 134519290
(E)-N-(2-methoxyethyl)-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide (PubChem CID 134519290) has the molecular formula C31H31F4N5O3 and a molecular weight of 597.61 g/mol. Its IUPAC name is (E)-N-(2-methoxyethyl)-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide.
| Compound Name | (E)-N-(2-methoxyethyl)-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
|---|---|
| PubChem CID | 134519290 |
| Molecular Formula | C31H31F4N5O3 |
| Molecular Weight | 597.61 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | (E)-N-(2-methoxyethyl)-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-enamide |
| SMILES | COCCNC(=O)/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1 |
| InChI | InChI=1S/C31H31F4N5O3/c1-42-16-15-37-27(41)8-5-13-36-14-17-43-28-12-10-23(20-38-28)29(22-9-11-26-24(18-22)30(32)40-39-26)25(19-31(33,34)35)21-6-3-2-4-7-21/h2-12,18,20,36H,13-17,19H2,1H3,(H,37,41)(H,39,40)/b8-5+,29-25- |
| InChIKey | CLTZBZDMZAMKGB-NEPUGLDOSA-N |
| XLogP | 5.30 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|