C33H33F4N5O2 — CID 134519303
(E)-1-piperidin-1-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one (PubChem CID 134519303) has the molecular formula C33H33F4N5O2 and a molecular weight of 607.65 g/mol. Its IUPAC name is (E)-1-piperidin-1-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one.
| Compound Name | (E)-1-piperidin-1-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
|---|---|
| PubChem CID | 134519303 |
| Molecular Formula | C33H33F4N5O2 |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.26 |
| IUPAC Name | (E)-1-piperidin-1-yl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(3-fluoro-2H-indazol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]but-2-en-1-one |
| SMILES | O=C(/C=C/CNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3n[nH]c(F)c3c2)cn1)N1CCCCC1 |
| InChI | InChI=1S/C33H33F4N5O2/c34-32-26-20-24(11-13-28(26)40-41-32)31(27(21-33(35,36)37)23-8-3-1-4-9-23)25-12-14-29(39-22-25)44-19-16-38-15-7-10-30(43)42-17-5-2-6-18-42/h1,3-4,7-14,20,22,38H,2,5-6,15-19,21H2,(H,40,41)/b10-7+,31-27- |
| InChIKey | DZTMKDIANJJADI-NPZFMRQQSA-N |
| XLogP | 6.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|