C13H20N4O3 — CID 134519915
(5R)-2,5-diamino-N'-[4-(hydroxymethyl)phenyl]hexanediamide (PubChem CID 134519915) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is (5R)-2,5-diamino-N'-[4-(hydroxymethyl)phenyl]hexanediamide.
| Compound Name | (5R)-2,5-diamino-N'-[4-(hydroxymethyl)phenyl]hexanediamide |
|---|---|
| PubChem CID | 134519915 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (5R)-2,5-diamino-N'-[4-(hydroxymethyl)phenyl]hexanediamide |
| SMILES | NC(=O)C(N)CC[C@@H](N)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C13H20N4O3/c14-10(12(16)19)5-6-11(15)13(20)17-9-3-1-8(7-18)2-4-9/h1-4,10-11,18H,5-7,14-15H2,(H2,16,19)(H,17,20)/t10?,11-/m1/s1 |
| InChIKey | UGWNTVSHVSILTA-RRKGBCIJSA-N |
| XLogP | -0.96 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |