C25H28FN3O4 — CID 134519966
benzyl N-[1-[[5-fluoro-2-(2-methylbut-3-enoylamino)phenyl]methylamino]-1-oxopent-4-en-2-yl]carbamate (PubChem CID 134519966) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is benzyl N-[1-[[5-fluoro-2-(2-methylbut-3-enoylamino)phenyl]methylamino]-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[5-fluoro-2-(2-methylbut-3-enoylamino)phenyl]methylamino]-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134519966 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | benzyl N-[1-[[5-fluoro-2-(2-methylbut-3-enoylamino)phenyl]methylamino]-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=CCC(NC(=O)OCc1ccccc1)C(=O)NCc1cc(F)ccc1NC(=O)C(C)C=C |
| InChI | InChI=1S/C25H28FN3O4/c1-4-9-22(29-25(32)33-16-18-10-7-6-8-11-18)24(31)27-15-19-14-20(26)12-13-21(19)28-23(30)17(3)5-2/h4-8,10-14,17,22H,1-2,9,15-16H2,3H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | ZIUQZLREDHACLF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|