C19H29NO4 — CID 134520030
[4-tert-butyl-2-[ethoxycarbonyl(methyl)amino]phenyl] 2,2-dimethylpropanoate (PubChem CID 134520030) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is [4-tert-butyl-2-[ethoxycarbonyl(methyl)amino]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-tert-butyl-2-[ethoxycarbonyl(methyl)amino]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134520030 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [4-tert-butyl-2-[ethoxycarbonyl(methyl)amino]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)N(C)c1cc(C(C)(C)C)ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H29NO4/c1-9-23-17(22)20(8)14-12-13(18(2,3)4)10-11-15(14)24-16(21)19(5,6)7/h10-12H,9H2,1-8H3 |
| InChIKey | LDSMFLIWQIWBMP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|