C31H30ClF4NO4S2 — CID 134521021
[4-(4-chloro-3-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-yl] trifluoromethanesulfonate (PubChem CID 134521021) has the molecular formula C31H30ClF4NO4S2 and a molecular weight of 656.16 g/mol. Its IUPAC name is [4-(4-chloro-3-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-yl] trifluoromethanesulfonate.
| Compound Name | [4-(4-chloro-3-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134521021 |
| Molecular Formula | C31H30ClF4NO4S2 |
| Molecular Weight | 656.16 g/mol |
| Exact Mass | 655.12 |
| IUPAC Name | [4-(4-chloro-3-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-2,3-dihydro-1-benzothiepin-8-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C2=C(c3ccc(O[C@H]4CCN(CCCF)C4)cc3)c3ccc(OS(=O)(=O)C(F)(F)F)cc3SCC2)ccc1Cl |
| InChI | InChI=1S/C31H30ClF4NO4S2/c1-20-17-22(5-10-28(20)32)26-12-16-42-29-18-24(41-43(38,39)31(34,35)36)8-9-27(29)30(26)21-3-6-23(7-4-21)40-25-11-15-37(19-25)14-2-13-33/h3-10,17-18,25H,2,11-16,19H2,1H3/t25-/m0/s1 |
| InChIKey | OVNJFVYYXDAKPG-VWLOTQADSA-N |
| XLogP | 8.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.16 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|