C16H22F3NO3 — CID 134521043
(3S)-3-[4-(dimethoxymethyl)-3,5-difluorophenoxy]-1-(3-fluoropropyl)pyrrolidine (PubChem CID 134521043) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (3S)-3-[4-(dimethoxymethyl)-3,5-difluorophenoxy]-1-(3-fluoropropyl)pyrrolidine.
| Compound Name | (3S)-3-[4-(dimethoxymethyl)-3,5-difluorophenoxy]-1-(3-fluoropropyl)pyrrolidine |
|---|---|
| PubChem CID | 134521043 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3S)-3-[4-(dimethoxymethyl)-3,5-difluorophenoxy]-1-(3-fluoropropyl)pyrrolidine |
| SMILES | COC(OC)c1c(F)cc(O[C@H]2CCN(CCCF)C2)cc1F |
| InChI | InChI=1S/C16H22F3NO3/c1-21-16(22-2)15-13(18)8-12(9-14(15)19)23-11-4-7-20(10-11)6-3-5-17/h8-9,11,16H,3-7,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | XHNHMZZMGLUOTN-NSHDSACASA-N |
| XLogP | 3.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|