C51H40N3OP — CID 134521867
N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-N-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphol-5-amine (PubChem CID 134521867) has the molecular formula C51H40N3OP and a molecular weight of 741.88 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-N-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphol-5-amine.
| Compound Name | N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-N-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphol-5-amine |
|---|---|
| PubChem CID | 134521867 |
| Molecular Formula | C51H40N3OP |
| Molecular Weight | 741.88 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | N-(9,9-dimethylfluoren-4-yl)-2-oxo-1,2,3-triphenyl-N-(4-phenylphenyl)-1,3,2λ5-benzodiazaphosphol-5-amine |
| SMILES | CC1(C)c2ccccc2-c2c(N(c3ccc(-c4ccccc4)cc3)c3ccc4c(c3)N(c3ccccc3)P(=O)(c3ccccc3)N4c3ccccc3)cccc21 |
| InChI | InChI=1S/C51H40N3OP/c1-51(2)45-27-16-15-26-44(45)50-46(51)28-17-29-48(50)52(39-32-30-38(31-33-39)37-18-7-3-8-19-37)42-34-35-47-49(36-42)54(41-22-11-5-12-23-41)56(55,43-24-13-6-14-25-43)53(47)40-20-9-4-10-21-40/h3-36H,1-2H3 |
| InChIKey | MJQOUZNFAGCNGW-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.88 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|