C22H18ClFN4O3S — CID 134522732
3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)indazole-6-carboxamide (PubChem CID 134522732) has the molecular formula C22H18ClFN4O3S and a molecular weight of 472.93 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)indazole-6-carboxamide.
| Compound Name | 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 134522732 |
| Molecular Formula | C22H18ClFN4O3S |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 3-(2-chlorophenyl)-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)indazole-6-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1ccc2c(-c3ccccc3Cl)nn(-c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C22H18ClFN4O3S/c23-19-4-2-1-3-17(19)21-18-10-5-14(22(29)26-11-12-32(25,30)31)13-20(18)28(27-21)16-8-6-15(24)7-9-16/h1-10,13H,11-12H2,(H,26,29)(H2,25,30,31) |
| InChIKey | YCFMIVNQCDCPNF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |