About 2-(1-isothiocyanatoethyl)-1,4-dioxane
2-(1-isothiocyanatoethyl)-1,4-dioxane (PubChem CID 134523073) has the molecular formula C7H11NO2S
and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-(1-isothiocyanatoethyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(1-isothiocyanatoethyl)-1,4-dioxane |
| PubChem CID | 134523073 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-(1-isothiocyanatoethyl)-1,4-dioxane |
| SMILES | CC(N=C=S)C1COCCO1 |
| InChI | InChI=1S/C7H11NO2S/c1-6(8-5-11)7-4-9-2-3-10-7/h6-7H,2-4H2,1H3 |
| InChIKey | UKQVFVKXKNMLSP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-isothiocyanatoethyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-isothiocyanatoethyl)-1,4-dioxane?
The IUPAC name of 2-(1-isothiocyanatoethyl)-1,4-dioxane (CID 134523073) is 2-(1-isothiocyanatoethyl)-1,4-dioxane.
What is the SMILES notation for 2-(1-isothiocyanatoethyl)-1,4-dioxane?
The canonical SMILES for 2-(1-isothiocyanatoethyl)-1,4-dioxane is CC(N=C=S)C1COCCO1.
What is the InChIKey of 2-(1-isothiocyanatoethyl)-1,4-dioxane?
The InChIKey is UKQVFVKXKNMLSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2S/c1-6(8-5-11)7-4-9-2-3-10-7/h6-7H,2-4H2,1H3.
What are the key properties of 2-(1-isothiocyanatoethyl)-1,4-dioxane?
2-(1-isothiocyanatoethyl)-1,4-dioxane has a molecular weight of 173.24 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-isothiocyanatoethyl)-1,4-dioxane is sourced from PubChem (CID 134523073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).