About 2,5-dihydrothiophene-3,4-dicarboxylic acid
2,5-dihydrothiophene-3,4-dicarboxylic acid (PubChem CID 13452321) has the molecular formula C6H6O4S
and a molecular weight of 174.18 g/mol. Its IUPAC name is 2,5-dihydrothiophene-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2,5-dihydrothiophene-3,4-dicarboxylic acid |
| PubChem CID | 13452321 |
| Molecular Formula | C6H6O4S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 2,5-dihydrothiophene-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)CSC1 |
| InChI | InChI=1S/C6H6O4S/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H2,(H,7,8)(H,9,10) |
| InChIKey | JNCDNHOVNQOIEI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-dihydrothiophene-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihydrothiophene-3,4-dicarboxylic acid?
The IUPAC name of 2,5-dihydrothiophene-3,4-dicarboxylic acid (CID 13452321) is 2,5-dihydrothiophene-3,4-dicarboxylic acid.
What is the SMILES notation for 2,5-dihydrothiophene-3,4-dicarboxylic acid?
The canonical SMILES for 2,5-dihydrothiophene-3,4-dicarboxylic acid is O=C(O)C1=C(C(=O)O)CSC1.
What is the InChIKey of 2,5-dihydrothiophene-3,4-dicarboxylic acid?
The InChIKey is JNCDNHOVNQOIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4S/c7-5(8)3-1-11-2-4(3)6(9)10/h1-2H2,(H,7,8)(H,9,10).
What are the key properties of 2,5-dihydrothiophene-3,4-dicarboxylic acid?
2,5-dihydrothiophene-3,4-dicarboxylic acid has a molecular weight of 174.18 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihydrothiophene-3,4-dicarboxylic acid is sourced from PubChem (CID 13452321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).