About 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol
2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol (PubChem CID 13452344) has the molecular formula C20H26OS2
and a molecular weight of 346.56 g/mol. Its IUPAC name is 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol.
Molecular Properties
| Compound Name | 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol |
| PubChem CID | 13452344 |
| Molecular Formula | C20H26OS2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol |
| SMILES | CC(C)C(O)C(Sc1ccccc1)(Sc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H26OS2/c1-15(2)19(21)20(16(3)4,22-17-11-7-5-8-12-17)23-18-13-9-6-10-14-18/h5-16,19,21H,1-4H3 |
| InChIKey | CTKYUXTVVGCISY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol?
The IUPAC name of 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol (CID 13452344) is 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol.
What is the SMILES notation for 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol?
The canonical SMILES for 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol is CC(C)C(O)C(Sc1ccccc1)(Sc1ccccc1)C(C)C.
What is the InChIKey of 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol?
The InChIKey is CTKYUXTVVGCISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26OS2/c1-15(2)19(21)20(16(3)4,22-17-11-7-5-8-12-17)23-18-13-9-6-10-14-18/h5-16,19,21H,1-4H3.
What are the key properties of 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol?
2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol has a molecular weight of 346.56 g/mol, XLogP of 5.94, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4,4-bis(phenylsulfanyl)hexan-3-ol is sourced from PubChem (CID 13452344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).