C24H32ClN7O6S — CID 134523706
(1R,2S)-1-(5-chloropyrimidin-2-yl)-N-[4-[(2R,6S)-2,6-dimethoxycyclohexyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide (PubChem CID 134523706) has the molecular formula C24H32ClN7O6S and a molecular weight of 582.08 g/mol. Its IUPAC name is (1R,2S)-1-(5-chloropyrimidin-2-yl)-N-[4-[(2R,6S)-2,6-dimethoxycyclohexyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide.
| Compound Name | (1R,2S)-1-(5-chloropyrimidin-2-yl)-N-[4-[(2R,6S)-2,6-dimethoxycyclohexyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 134523706 |
| Molecular Formula | C24H32ClN7O6S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | (1R,2S)-1-(5-chloropyrimidin-2-yl)-N-[4-[(2R,6S)-2,6-dimethoxycyclohexyl]-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-methoxypropane-2-sulfonamide |
| SMILES | COc1cccc(-c2nnc(NS(=O)(=O)[C@@H](C)[C@H](OC)c3ncc(Cl)cn3)n2C2[C@@H](OC)CCC[C@H]2OC)n1 |
| InChI | InChI=1S/C24H32ClN7O6S/c1-14(21(38-5)22-26-12-15(25)13-27-22)39(33,34)31-24-30-29-23(16-8-6-11-19(28-16)37-4)32(24)20-17(35-2)9-7-10-18(20)36-3/h6,8,11-14,17-18,20-21H,7,9-10H2,1-5H3,(H,30,31)/t14-,17-,18+,20?,21-/m0/s1 |
| InChIKey | WVEZDRPOELHRLZ-CTVKAJMBSA-N |
| XLogP | 3.07 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |