C12H10N4O3 — CID 134523808
methyl 3-(5-cyano-4-methyl-2-pyridinyl)-2-oxo-1H-imidazole-5-carboxylate (PubChem CID 134523808) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is methyl 3-(5-cyano-4-methyl-2-pyridinyl)-2-oxo-1H-imidazole-5-carboxylate.
| Compound Name | methyl 3-(5-cyano-4-methyl-2-pyridinyl)-2-oxo-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 134523808 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 3-(5-cyano-4-methyl-2-pyridinyl)-2-oxo-1H-imidazole-5-carboxylate |
| SMILES | COC(=O)c1cn(-c2cc(C)c(C#N)cn2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N4O3/c1-7-3-10(14-5-8(7)4-13)16-6-9(11(17)19-2)15-12(16)18/h3,5-6H,1-2H3,(H,15,18) |
| InChIKey | SSXJBURGUORAJO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |