C13H16N2O6S — CID 134523826
[(2R)-2-(methanesulfonamido)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]carbamic acid (PubChem CID 134523826) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is [(2R)-2-(methanesulfonamido)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]carbamic acid.
| Compound Name | [(2R)-2-(methanesulfonamido)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 134523826 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [(2R)-2-(methanesulfonamido)-2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]carbamic acid |
| SMILES | Cc1c([C@H](CNC(=O)O)NS(C)(=O)=O)ccc2c1COC2=O |
| InChI | InChI=1S/C13H16N2O6S/c1-7-8(3-4-9-10(7)6-21-12(9)16)11(5-14-13(17)18)15-22(2,19)20/h3-4,11,14-15H,5-6H2,1-2H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | VCWBAZMPCUBTLJ-NSHDSACASA-N |
| XLogP | 0.52 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |