C29H34O2S — CID 134524624
4-[9-butyl-2-methyl-7-(4-methylphenyl)fluoren-9-yl]butane-1-sulfinic acid (PubChem CID 134524624) has the molecular formula C29H34O2S and a molecular weight of 446.66 g/mol. Its IUPAC name is 4-[9-butyl-2-methyl-7-(4-methylphenyl)fluoren-9-yl]butane-1-sulfinic acid.
| Compound Name | 4-[9-butyl-2-methyl-7-(4-methylphenyl)fluoren-9-yl]butane-1-sulfinic acid |
|---|---|
| PubChem CID | 134524624 |
| Molecular Formula | C29H34O2S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4-[9-butyl-2-methyl-7-(4-methylphenyl)fluoren-9-yl]butane-1-sulfinic acid |
| SMILES | CCCCC1(CCCCS(=O)O)c2cc(C)ccc2-c2ccc(-c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C29H34O2S/c1-4-5-16-29(17-6-7-18-32(30)31)27-19-22(3)10-14-25(27)26-15-13-24(20-28(26)29)23-11-8-21(2)9-12-23/h8-15,19-20H,4-7,16-18H2,1-3H3,(H,30,31) |
| InChIKey | QPQQAGDMBHLHEM-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|