C14H16N2 — CID 134524701
(2E,4Z)-N,2-bis(ethenyl)-N'-ethynyl-N-methylhepta-2,4,6-trienimidamide (PubChem CID 134524701) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is (2E,4Z)-N,2-bis(ethenyl)-N'-ethynyl-N-methylhepta-2,4,6-trienimidamide.
| Compound Name | (2E,4Z)-N,2-bis(ethenyl)-N'-ethynyl-N-methylhepta-2,4,6-trienimidamide |
|---|---|
| PubChem CID | 134524701 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2E,4Z)-N,2-bis(ethenyl)-N'-ethynyl-N-methylhepta-2,4,6-trienimidamide |
| SMILES | C#C/N=C(C(/C=C)=C/C=C\C=C)\N(C)C=C |
| InChI | InChI=1S/C14H16N2/c1-6-10-11-12-13(7-2)14(15-8-3)16(5)9-4/h3,6-7,9-12H,1-2,4H2,5H3/b11-10-,13-12+,15-14- |
| InChIKey | DVQLMUUSBAPWQG-QMAYGUQNSA-N |
| XLogP | 2.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|