About 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene
2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene (PubChem CID 134525122) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene.
Analyze 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene?
The IUPAC name of 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene (CID 134525122) is 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene.
What is the SMILES notation for 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene?
The canonical SMILES for 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene is CC(C)C1=CC=C=NC(C(C)C)=C1.
What is the InChIKey of 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene?
The InChIKey is AFOKWILTJDLMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-9(2)11-6-5-7-13-12(8-11)10(3)4/h5-6,8-10H,1-4H3.
What are the key properties of 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene?
2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene has a molecular weight of 175.27 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-di(propan-2-yl)-1-azacyclohepta-2,4,6,7-tetraene is sourced from PubChem (CID 134525122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).