C22H32N2 — CID 134525287
(2E,4Z,6E)-6-[C-methyl-N-[[(3E)-3-(2-methylpropylidene)cyclohexen-1-yl]methyl]carbonimidoyl]nona-2,4,6,8-tetraen-3-amine (PubChem CID 134525287) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (2E,4Z,6E)-6-[C-methyl-N-[[(3E)-3-(2-methylpropylidene)cyclohexen-1-yl]methyl]carbonimidoyl]nona-2,4,6,8-tetraen-3-amine.
| Compound Name | (2E,4Z,6E)-6-[C-methyl-N-[[(3E)-3-(2-methylpropylidene)cyclohexen-1-yl]methyl]carbonimidoyl]nona-2,4,6,8-tetraen-3-amine |
|---|---|
| PubChem CID | 134525287 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (2E,4Z,6E)-6-[C-methyl-N-[[(3E)-3-(2-methylpropylidene)cyclohexen-1-yl]methyl]carbonimidoyl]nona-2,4,6,8-tetraen-3-amine |
| SMILES | C=C/C=C(\C=C/C(N)=C\C)C(/C)=N/CC1=C/C(=C/C(C)C)CCC1 |
| InChI | InChI=1S/C22H32N2/c1-6-9-21(12-13-22(23)7-2)18(5)24-16-20-11-8-10-19(15-20)14-17(3)4/h6-7,9,12-15,17H,1,8,10-11,16,23H2,2-5H3/b13-12-,19-14+,21-9+,22-7+,24-18+ |
| InChIKey | VKEWFCYTQXIQIT-DKAPSBHLSA-N |
| XLogP | 5.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|