C13H24N2 — CID 134525395
N'-ethyl-N-methyl-N'-[(3Z,5Z)-5-methylocta-3,5,7-trienyl]methanediamine (PubChem CID 134525395) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N'-[(3Z,5Z)-5-methylocta-3,5,7-trienyl]methanediamine.
| Compound Name | N'-ethyl-N-methyl-N'-[(3Z,5Z)-5-methylocta-3,5,7-trienyl]methanediamine |
|---|---|
| PubChem CID | 134525395 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N'-ethyl-N-methyl-N'-[(3Z,5Z)-5-methylocta-3,5,7-trienyl]methanediamine |
| SMILES | C=C/C=C(C)\C=C/CCN(CC)CNC |
| InChI | InChI=1S/C13H24N2/c1-5-9-13(3)10-7-8-11-15(6-2)12-14-4/h5,7,9-10,14H,1,6,8,11-12H2,2-4H3/b10-7-,13-9- |
| InChIKey | LJICWNIQVVDZAC-PGQZVBALSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|