C25H41N5 — CID 134525423
(1Z,3Z)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-ethenyl-N'-methyl-N'-[2-(methylamino)ethyl]-1-(methylideneamino)-N-propan-2-ylhexa-1,3-diene-1,6-diamine (PubChem CID 134525423) has the molecular formula C25H41N5 and a molecular weight of 411.64 g/mol. Its IUPAC name is (1Z,3Z)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-ethenyl-N'-methyl-N'-[2-(methylamino)ethyl]-1-(methylideneamino)-N-propan-2-ylhexa-1,3-diene-1,6-diamine.
| Compound Name | (1Z,3Z)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-ethenyl-N'-methyl-N'-[2-(methylamino)ethyl]-1-(methylideneamino)-N-propan-2-ylhexa-1,3-diene-1,6-diamine |
|---|---|
| PubChem CID | 134525423 |
| Molecular Formula | C25H41N5 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.34 |
| IUPAC Name | (1Z,3Z)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-ethenyl-N'-methyl-N'-[2-(methylamino)ethyl]-1-(methylideneamino)-N-propan-2-ylhexa-1,3-diene-1,6-diamine |
| SMILES | C=CC(/C(=C\CCN(C)CCNC)CC1=C(C)C=C(C)NC1=C)=C(/N=C)NC(C)C |
| InChI | InChI=1S/C25H41N5/c1-10-23(25(27-8)28-18(2)3)22(12-11-14-30(9)15-13-26-7)17-24-19(4)16-20(5)29-21(24)6/h10,12,16,18,26,28-29H,1,6,8,11,13-15,17H2,2-5,7,9H3/b22-12-,25-23+ |
| InChIKey | YVCKZWITTMXULP-UVWUGLSHSA-N |
| XLogP | 4.28 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|