C18H30N4 — CID 134525481
(1E,3E)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-methyl-1-N'-propan-2-ylpenta-1,3-diene-1,1,5-triamine (PubChem CID 134525481) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is (1E,3E)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-methyl-1-N'-propan-2-ylpenta-1,3-diene-1,1,5-triamine.
| Compound Name | (1E,3E)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-methyl-1-N'-propan-2-ylpenta-1,3-diene-1,1,5-triamine |
|---|---|
| PubChem CID | 134525481 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | (1E,3E)-3-[(4,6-dimethyl-2-methylidene-1H-pyridin-3-yl)methyl]-2-methyl-1-N'-propan-2-ylpenta-1,3-diene-1,1,5-triamine |
| SMILES | C=C1NC(C)=CC(C)=C1CC(=C\CN)/C(C)=C(\N)NC(C)C |
| InChI | InChI=1S/C18H30N4/c1-11(2)21-18(20)14(5)16(7-8-19)10-17-12(3)9-13(4)22-15(17)6/h7,9,11,21-22H,6,8,10,19-20H2,1-5H3/b16-7+,18-14+ |
| InChIKey | RDXYOYWORCVPKJ-WKGGMIEISA-N |
| XLogP | 2.79 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|