C19H31N3 — CID 134525558
3-[[(1E,3Z)-2,3-dimethyl-1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)penta-1,3-dienyl]amino]propanenitrile (PubChem CID 134525558) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 3-[[(1E,3Z)-2,3-dimethyl-1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)penta-1,3-dienyl]amino]propanenitrile.
| Compound Name | 3-[[(1E,3Z)-2,3-dimethyl-1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)penta-1,3-dienyl]amino]propanenitrile |
|---|---|
| PubChem CID | 134525558 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 3-[[(1E,3Z)-2,3-dimethyl-1-(2,2,6,6-tetramethyl-1,3-dihydropyridin-4-yl)penta-1,3-dienyl]amino]propanenitrile |
| SMILES | C/C=C(C)\C(C)=C(\NCCC#N)C1=CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C19H31N3/c1-8-14(2)15(3)17(21-11-9-10-20)16-12-18(4,5)22-19(6,7)13-16/h8,12,21-22H,9,11,13H2,1-7H3/b14-8-,17-15+ |
| InChIKey | ZRQPPWMBSMATMB-VEVMYOGCSA-N |
| XLogP | 4.21 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|