C9H16N2O — CID 134525628
N-[(2Z,4E)-6-amino-4,5-dimethylhexa-2,4-dien-2-yl]formamide (PubChem CID 134525628) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is N-[(2Z,4E)-6-amino-4,5-dimethylhexa-2,4-dien-2-yl]formamide.
| Compound Name | N-[(2Z,4E)-6-amino-4,5-dimethylhexa-2,4-dien-2-yl]formamide |
|---|---|
| PubChem CID | 134525628 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-[(2Z,4E)-6-amino-4,5-dimethylhexa-2,4-dien-2-yl]formamide |
| SMILES | C/C(=C/C(C)=C(\C)CN)NC=O |
| InChI | InChI=1S/C9H16N2O/c1-7(8(2)5-10)4-9(3)11-6-12/h4,6H,5,10H2,1-3H3,(H,11,12)/b8-7+,9-4- |
| InChIKey | ODVNOFBPTKDSOU-KCKXTUGSSA-N |
| XLogP | 0.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|