C18H32N4 — CID 134525665
4-[(3E,5E)-9-amino-6-methanimidoyl-5-methylnona-1,3,5-trien-3-yl]-N,N-dimethylpiperidin-1-amine (PubChem CID 134525665) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is 4-[(3E,5E)-9-amino-6-methanimidoyl-5-methylnona-1,3,5-trien-3-yl]-N,N-dimethylpiperidin-1-amine.
| Compound Name | 4-[(3E,5E)-9-amino-6-methanimidoyl-5-methylnona-1,3,5-trien-3-yl]-N,N-dimethylpiperidin-1-amine |
|---|---|
| PubChem CID | 134525665 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 4-[(3E,5E)-9-amino-6-methanimidoyl-5-methylnona-1,3,5-trien-3-yl]-N,N-dimethylpiperidin-1-amine |
| SMILES | [H]/N=C/C(CCCN)=C(C)/C=C(\C=C)C1CCN(N(C)C)CC1 |
| InChI | InChI=1S/C18H32N4/c1-5-16(13-15(2)18(14-20)7-6-10-19)17-8-11-22(12-9-17)21(3)4/h5,13-14,17,20H,1,6-12,19H2,2-4H3/b16-13+,18-15+,20-14+ |
| InChIKey | VNPCQRBOMXBQOM-LZPPJCQVSA-N |
| XLogP | 2.99 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|