About 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium
1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium (PubChem CID 13452635) has the molecular formula C9H12N+
and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium |
| PubChem CID | 13452635 |
| Molecular Formula | C9H12N+ |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.10 |
| IUPAC Name | 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium |
| SMILES | C[n+]1cccc2c1CCC2 |
| InChI | InChI=1S/C9H12N/c1-10-7-3-5-8-4-2-6-9(8)10/h3,5,7H,2,4,6H2,1H3/q+1 |
| InChIKey | DRMXUUVVMOAAHO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium?
The IUPAC name of 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium (CID 13452635) is 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium.
What is the SMILES notation for 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium?
The canonical SMILES for 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium is C[n+]1cccc2c1CCC2.
What is the InChIKey of 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium?
The InChIKey is DRMXUUVVMOAAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N/c1-10-7-3-5-8-4-2-6-9(8)10/h3,5,7H,2,4,6H2,1H3/q+1.
What are the key properties of 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium?
1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium has a molecular weight of 134.20 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6,7-dihydro-5H-cyclopenta[b]pyridin-1-ium is sourced from PubChem (CID 13452635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).