C22H34N2O — CID 134526366
(2E,15E,17E)-3,15-dimethyl-4,18-dimethylidene-17-prop-2-enylidene-1-oxa-5,14-diazacyclooctadeca-2,15-diene (PubChem CID 134526366) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (2E,15E,17E)-3,15-dimethyl-4,18-dimethylidene-17-prop-2-enylidene-1-oxa-5,14-diazacyclooctadeca-2,15-diene.
| Compound Name | (2E,15E,17E)-3,15-dimethyl-4,18-dimethylidene-17-prop-2-enylidene-1-oxa-5,14-diazacyclooctadeca-2,15-diene |
|---|---|
| PubChem CID | 134526366 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (2E,15E,17E)-3,15-dimethyl-4,18-dimethylidene-17-prop-2-enylidene-1-oxa-5,14-diazacyclooctadeca-2,15-diene |
| SMILES | C=C/C=C1\C=C(/C)NCCCCCCCCNC(=C)/C(C)=C/OC1=C |
| InChI | InChI=1S/C22H34N2O/c1-6-13-22-16-19(3)23-14-11-9-7-8-10-12-15-24-20(4)18(2)17-25-21(22)5/h6,13,16-17,23-24H,1,4-5,7-12,14-15H2,2-3H3/b18-17+,19-16+,22-13+ |
| InChIKey | PZAVOKSDLHWJGA-GBXCRKMTSA-N |
| XLogP | 5.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |