C20H32N2 — CID 134526418
1,5-dimethyl-6-[(6E,7Z)-8-methyl-6-propylidenedeca-4,7-dien-5-yl]-4H-pyrimidine (PubChem CID 134526418) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 1,5-dimethyl-6-[(6E,7Z)-8-methyl-6-propylidenedeca-4,7-dien-5-yl]-4H-pyrimidine.
| Compound Name | 1,5-dimethyl-6-[(6E,7Z)-8-methyl-6-propylidenedeca-4,7-dien-5-yl]-4H-pyrimidine |
|---|---|
| PubChem CID | 134526418 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 1,5-dimethyl-6-[(6E,7Z)-8-methyl-6-propylidenedeca-4,7-dien-5-yl]-4H-pyrimidine |
| SMILES | CC/C=C(\C=C(\C)CC)C(=CCCC)C1=C(C)CN=CN1C |
| InChI | InChI=1S/C20H32N2/c1-7-10-12-19(18(11-8-2)13-16(4)9-3)20-17(5)14-21-15-22(20)6/h11-13,15H,7-10,14H2,1-6H3/b16-13-,18-11+,19-12? |
| InChIKey | XUCAFPWVLOKVQJ-JLVVWZAYSA-N |
| XLogP | 5.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|