C22H35NO3S — CID 134526509
2-[3-(cyclohexylmethylsulfanylamino)-2,5,6-trimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 134526509) has the molecular formula C22H35NO3S and a molecular weight of 393.59 g/mol. Its IUPAC name is 2-[3-(cyclohexylmethylsulfanylamino)-2,5,6-trimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[3-(cyclohexylmethylsulfanylamino)-2,5,6-trimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 134526509 |
| Molecular Formula | C22H35NO3S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-[3-(cyclohexylmethylsulfanylamino)-2,5,6-trimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | Cc1cc(NSCC2CCCCC2)c(C)c(C(OC(C)(C)C)C(=O)O)c1C |
| InChI | InChI=1S/C22H35NO3S/c1-14-12-18(23-27-13-17-10-8-7-9-11-17)16(3)19(15(14)2)20(21(24)25)26-22(4,5)6/h12,17,20,23H,7-11,13H2,1-6H3,(H,24,25) |
| InChIKey | VIJCWQBOOLEFDI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|