C16H30OS — CID 134526686
(3Z,5E)-3-tert-butyl-8,8-dimethyl-5-methylsulfanylnona-3,5-dien-2-ol (PubChem CID 134526686) has the molecular formula C16H30OS and a molecular weight of 270.48 g/mol. Its IUPAC name is (3Z,5E)-3-tert-butyl-8,8-dimethyl-5-methylsulfanylnona-3,5-dien-2-ol.
| Compound Name | (3Z,5E)-3-tert-butyl-8,8-dimethyl-5-methylsulfanylnona-3,5-dien-2-ol |
|---|---|
| PubChem CID | 134526686 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (3Z,5E)-3-tert-butyl-8,8-dimethyl-5-methylsulfanylnona-3,5-dien-2-ol |
| SMILES | CSC(/C=C(\C(C)O)C(C)(C)C)=C/CC(C)(C)C |
| InChI | InChI=1S/C16H30OS/c1-12(17)14(16(5,6)7)11-13(18-8)9-10-15(2,3)4/h9,11-12,17H,10H2,1-8H3/b13-9+,14-11+ |
| InChIKey | VTRZRZGHTQDXEU-IJFRVEDASA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|