C29H56N2 — CID 134526689
(E)-N,2-dimethyl-8-(methylideneamino)-N-[(Z)-prop-1-enyl]-3-(4,5,7-trimethyloctan-4-yl)dodec-8-en-1-amine (PubChem CID 134526689) has the molecular formula C29H56N2 and a molecular weight of 432.78 g/mol. Its IUPAC name is (E)-N,2-dimethyl-8-(methylideneamino)-N-[(Z)-prop-1-enyl]-3-(4,5,7-trimethyloctan-4-yl)dodec-8-en-1-amine.
| Compound Name | (E)-N,2-dimethyl-8-(methylideneamino)-N-[(Z)-prop-1-enyl]-3-(4,5,7-trimethyloctan-4-yl)dodec-8-en-1-amine |
|---|---|
| PubChem CID | 134526689 |
| Molecular Formula | C29H56N2 |
| Molecular Weight | 432.78 g/mol |
| Exact Mass | 432.44 |
| IUPAC Name | (E)-N,2-dimethyl-8-(methylideneamino)-N-[(Z)-prop-1-enyl]-3-(4,5,7-trimethyloctan-4-yl)dodec-8-en-1-amine |
| SMILES | C=N/C(=C/CCC)CCCCC(C(C)CN(C)/C=C\C)C(C)(CCC)C(C)CC(C)C |
| InChI | InChI=1S/C29H56N2/c1-11-14-17-27(30-9)18-15-16-19-28(25(6)23-31(10)21-13-3)29(8,20-12-2)26(7)22-24(4)5/h13,17,21,24-26,28H,9,11-12,14-16,18-20,22-23H2,1-8,10H3/b21-13-,27-17+ |
| InChIKey | DFCHKIRHKCKDRN-DDPAVWOSSA-N |
| XLogP | 9.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.78 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|