C12H17N3O6S — CID 134526692
[4-[2-[[2-(methoxycarbonylamino)acetyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 134526692) has the molecular formula C12H17N3O6S and a molecular weight of 331.35 g/mol. Its IUPAC name is [4-[2-[[2-(methoxycarbonylamino)acetyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[[2-(methoxycarbonylamino)acetyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 134526692 |
| Molecular Formula | C12H17N3O6S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [4-[2-[[2-(methoxycarbonylamino)acetyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)NCC(=O)NCCc1ccc(NS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H17N3O6S/c1-21-12(17)14-8-11(16)13-7-6-9-2-4-10(5-3-9)15-22(18,19)20/h2-5,15H,6-8H2,1H3,(H,13,16)(H,14,17)(H,18,19,20) |
| InChIKey | JDWSAFQHSNKKMX-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|