C16H28N2 — CID 134526711
(4Z)-N,N-diethyl-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-4,6-dien-3-amine (PubChem CID 134526711) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (4Z)-N,N-diethyl-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-4,6-dien-3-amine.
| Compound Name | (4Z)-N,N-diethyl-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-4,6-dien-3-amine |
|---|---|
| PubChem CID | 134526711 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (4Z)-N,N-diethyl-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-4,6-dien-3-amine |
| SMILES | C=C/C=C(C(=C/C)\N=C\C)/C(CC)N(CC)CC |
| InChI | InChI=1S/C16H28N2/c1-7-13-14(15(8-2)17-10-4)16(9-3)18(11-5)12-6/h7-8,10,13,16H,1,9,11-12H2,2-6H3/b14-13+,15-8+,17-10+ |
| InChIKey | SFSJQVRCEYTRKQ-LSEPDTONSA-N |
| XLogP | 4.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|