About 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran
6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran (PubChem CID 134526728) has the molecular formula C7H11ClS
and a molecular weight of 162.69 g/mol. Its IUPAC name is 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran |
| PubChem CID | 134526728 |
| Molecular Formula | C7H11ClS |
| Molecular Weight | 162.69 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran |
| SMILES | CC1=CC(Cl)SC(C)C1 |
| InChI | InChI=1S/C7H11ClS/c1-5-3-6(2)9-7(8)4-5/h4,6-7H,3H2,1-2H3 |
| InChIKey | GGELWNNBFLLKGG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran?
The IUPAC name of 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran (CID 134526728) is 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran.
What is the SMILES notation for 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran?
The canonical SMILES for 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran is CC1=CC(Cl)SC(C)C1.
What is the InChIKey of 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran?
The InChIKey is GGELWNNBFLLKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClS/c1-5-3-6(2)9-7(8)4-5/h4,6-7H,3H2,1-2H3.
What are the key properties of 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran?
6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran has a molecular weight of 162.69 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,4-dimethyl-3,6-dihydro-2H-thiopyran is sourced from PubChem (CID 134526728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).