About 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene
1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene (PubChem CID 134526742) has the molecular formula C10H16S
and a molecular weight of 168.31 g/mol. Its IUPAC name is 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene.
Analyze 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene?
The IUPAC name of 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene (CID 134526742) is 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene.
What is the SMILES notation for 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene?
The canonical SMILES for 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene is CC1=C2CCCCC2C(C)S1.
What is the InChIKey of 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene?
The InChIKey is AFZJCZITVBXVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c1-7-9-5-3-4-6-10(9)8(2)11-7/h7,9H,3-6H2,1-2H3.
What are the key properties of 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene?
1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene has a molecular weight of 168.31 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1,4,5,6,7,7a-hexahydro-2-benzothiophene is sourced from PubChem (CID 134526742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).