C14H23NS — CID 134526773
(3E,10E)-11-(propan-2-ylideneamino)undeca-3,7,10-triene-2-thiol (PubChem CID 134526773) has the molecular formula C14H23NS and a molecular weight of 237.41 g/mol. Its IUPAC name is (3E,10E)-11-(propan-2-ylideneamino)undeca-3,7,10-triene-2-thiol.
| Compound Name | (3E,10E)-11-(propan-2-ylideneamino)undeca-3,7,10-triene-2-thiol |
|---|---|
| PubChem CID | 134526773 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (3E,10E)-11-(propan-2-ylideneamino)undeca-3,7,10-triene-2-thiol |
| SMILES | CC(C)=N/C=C/CC=CCC/C=C/C(C)S |
| InChI | InChI=1S/C14H23NS/c1-13(2)15-12-10-8-6-4-5-7-9-11-14(3)16/h4,6,9-12,14,16H,5,7-8H2,1-3H3/b6-4?,11-9+,12-10+ |
| InChIKey | POTWLOZFCVCYPF-SGEYMFIWSA-N |
| XLogP | 4.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|