C15H25N — CID 134526812
(5E,9E)-2,4,5,7,8,10-hexamethyl-3,4,7,8-tetrahydroazecine (PubChem CID 134526812) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (5E,9E)-2,4,5,7,8,10-hexamethyl-3,4,7,8-tetrahydroazecine.
| Compound Name | (5E,9E)-2,4,5,7,8,10-hexamethyl-3,4,7,8-tetrahydroazecine |
|---|---|
| PubChem CID | 134526812 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (5E,9E)-2,4,5,7,8,10-hexamethyl-3,4,7,8-tetrahydroazecine |
| SMILES | C/C1=N/C(C)=C/C(C)C(C)/C=C(\C)C(C)C1 |
| InChI | InChI=1S/C15H25N/c1-10-7-11(2)13(4)9-15(6)16-14(5)8-12(10)3/h7-8,10,12-13H,9H2,1-6H3/b11-7+,14-8+,16-15- |
| InChIKey | AYXLVMUKQAFAEH-PBIZLWCASA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|