C11H20N2O2 — CID 134526883
(2E,4Z,6E)-2-amino-7-methyl-9-(methylamino)nona-2,4,6-triene-4,5-diol (PubChem CID 134526883) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (2E,4Z,6E)-2-amino-7-methyl-9-(methylamino)nona-2,4,6-triene-4,5-diol.
| Compound Name | (2E,4Z,6E)-2-amino-7-methyl-9-(methylamino)nona-2,4,6-triene-4,5-diol |
|---|---|
| PubChem CID | 134526883 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (2E,4Z,6E)-2-amino-7-methyl-9-(methylamino)nona-2,4,6-triene-4,5-diol |
| SMILES | CNCC/C(C)=C/C(O)=C(O)\C=C(/C)N |
| InChI | InChI=1S/C11H20N2O2/c1-8(4-5-13-3)6-10(14)11(15)7-9(2)12/h6-7,13-15H,4-5,12H2,1-3H3/b8-6+,9-7+,11-10- |
| InChIKey | LJONOKMCOXTXNP-AIEOQPFWSA-N |
| XLogP | 1.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|